C17H15Cl2N3O3 — CID 170427452
6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole-2-carboxylic acid (PubChem CID 170427452) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is 6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole-2-carboxylic acid.
| Compound Name | 6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170427452 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(Cl)c(Cl)ccc2c1-c1cnn(C2CCCCO2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-11-5-4-10-13(16(17(23)24)21-15(10)14(11)19)9-7-20-22(8-9)12-3-1-2-6-25-12/h4-5,7-8,12,21H,1-3,6H2,(H,23,24) |
| InChIKey | ZBPSNLBBLKUXRU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |