C23H28Cl2N6O2Si — CID 170550425
[6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1-[1-(trimethylsilylmethyl)triazol-4-yl]indol-2-yl]methanol (PubChem CID 170550425) has the molecular formula C23H28Cl2N6O2Si and a molecular weight of 519.51 g/mol. Its IUPAC name is [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1-[1-(trimethylsilylmethyl)triazol-4-yl]indol-2-yl]methanol.
| Compound Name | [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1-[1-(trimethylsilylmethyl)triazol-4-yl]indol-2-yl]methanol |
|---|---|
| PubChem CID | 170550425 |
| Molecular Formula | C23H28Cl2N6O2Si |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1-[1-(trimethylsilylmethyl)triazol-4-yl]indol-2-yl]methanol |
| SMILES | C[Si](C)(C)Cn1cc(-n2c(CO)c(-c3cnn(C4CCCCO4)c3)c3ccc(Cl)c(Cl)c32)nn1 |
| InChI | InChI=1S/C23H28Cl2N6O2Si/c1-34(2,3)14-29-12-19(27-28-29)31-18(13-32)21(16-7-8-17(24)22(25)23(16)31)15-10-26-30(11-15)20-6-4-5-9-33-20/h7-8,10-12,20,32H,4-6,9,13-14H2,1-3H3 |
| InChIKey | BFFNBVIMPIHUSQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|