C14H8BrCl2NO2S — CID 170427261
1-(benzenesulfonyl)-3-bromo-6,7-dichloroindole (PubChem CID 170427261) has the molecular formula C14H8BrCl2NO2S and a molecular weight of 405.10 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-bromo-6,7-dichloroindole.
| Compound Name | 1-(benzenesulfonyl)-3-bromo-6,7-dichloroindole |
|---|---|
| PubChem CID | 170427261 |
| Molecular Formula | C14H8BrCl2NO2S |
| Molecular Weight | 405.10 g/mol |
| Exact Mass | 402.88 |
| IUPAC Name | 1-(benzenesulfonyl)-3-bromo-6,7-dichloroindole |
| SMILES | O=S(=O)(c1ccccc1)n1cc(Br)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C14H8BrCl2NO2S/c15-11-8-18(14-10(11)6-7-12(16)13(14)17)21(19,20)9-4-2-1-3-5-9/h1-8H |
| InChIKey | DKEJUHNLHOMVHW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.10 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |