C14H8BrN3O2S — CID 167376001
1-(benzenesulfonyl)-3-bromo-6-isocyanopyrrolo[2,3-b]pyridine (PubChem CID 167376001) has the molecular formula C14H8BrN3O2S and a molecular weight of 362.21 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-bromo-6-isocyanopyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-3-bromo-6-isocyanopyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 167376001 |
| Molecular Formula | C14H8BrN3O2S |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 1-(benzenesulfonyl)-3-bromo-6-isocyanopyrrolo[2,3-b]pyridine |
| SMILES | [C-]#[N+]c1ccc2c(Br)cn(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C14H8BrN3O2S/c1-16-13-8-7-11-12(15)9-18(14(11)17-13)21(19,20)10-5-3-2-4-6-10/h2-9H |
| InChIKey | NMBGSLNSBJSODY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|