C22H38O3 — CID 11868024
(5S,8R,9R,10R,13R,14R)-3,3-dimethoxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol (PubChem CID 11868024) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (5S,8R,9R,10R,13R,14R)-3,3-dimethoxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol.
| Compound Name | (5S,8R,9R,10R,13R,14R)-3,3-dimethoxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol |
|---|---|
| PubChem CID | 11868024 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (5S,8R,9R,10R,13R,14R)-3,3-dimethoxy-5,10,13-trimethyl-1,2,4,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol |
| SMILES | COC1(OC)CC[C@]2(C)[C@@H]3CC[C@@]4(C)CCC[C@@]4(O)[C@@H]3CC[C@@]2(C)C1 |
| InChI | InChI=1S/C22H38O3/c1-18-9-6-10-22(18,23)17-8-12-19(2)15-21(24-4,25-5)14-13-20(19,3)16(17)7-11-18/h16-17,23H,6-15H2,1-5H3/t16-,17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | FALJCKNYMNNQLF-CFBOQIOASA-N |
| XLogP | 4.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|