C22H36O4 — CID 124916866
(5S,8S,9R,10R,13S,14R)-14-hydroxy-3,3-dimethoxy-5,10,13-trimethyl-2,4,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124916866) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (5S,8S,9R,10R,13S,14R)-14-hydroxy-3,3-dimethoxy-5,10,13-trimethyl-2,4,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5S,8S,9R,10R,13S,14R)-14-hydroxy-3,3-dimethoxy-5,10,13-trimethyl-2,4,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124916866 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (5S,8S,9R,10R,13S,14R)-14-hydroxy-3,3-dimethoxy-5,10,13-trimethyl-2,4,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | COC1(OC)CC[C@]2(C)[C@@H]3CC[C@]4(C)C(=O)CC[C@@]4(O)[C@H]3CC[C@@]2(C)C1 |
| InChI | InChI=1S/C22H36O4/c1-18-9-6-16-15(7-10-20(3)17(23)8-11-22(16,20)24)19(18,2)12-13-21(14-18,25-4)26-5/h15-16,24H,6-14H2,1-5H3/t15-,16+,18+,19-,20-,22-/m1/s1 |
| InChIKey | XHSWJTDGBUQZOI-OTMRLVHASA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|