About (2-oxopentylamino) 5-azidopentanoate
(2-oxopentylamino) 5-azidopentanoate (PubChem CID 118680626) has the molecular formula C10H18N4O3
and a molecular weight of 242.28 g/mol. Its IUPAC name is (2-oxopentylamino) 5-azidopentanoate.
Molecular Properties
| Compound Name | (2-oxopentylamino) 5-azidopentanoate |
| PubChem CID | 118680626 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (2-oxopentylamino) 5-azidopentanoate |
| SMILES | CCCC(=O)CNOC(=O)CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C10H18N4O3/c1-2-5-9(15)8-13-17-10(16)6-3-4-7-12-14-11/h13H,2-8H2,1H3 |
| InChIKey | QACWKVLVZQFRIM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxopentylamino) 5-azidopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopentylamino) 5-azidopentanoate?
The IUPAC name of (2-oxopentylamino) 5-azidopentanoate (CID 118680626) is (2-oxopentylamino) 5-azidopentanoate.
What is the SMILES notation for (2-oxopentylamino) 5-azidopentanoate?
The canonical SMILES for (2-oxopentylamino) 5-azidopentanoate is CCCC(=O)CNOC(=O)CCCCN=[N+]=[N-].
What is the InChIKey of (2-oxopentylamino) 5-azidopentanoate?
The InChIKey is QACWKVLVZQFRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O3/c1-2-5-9(15)8-13-17-10(16)6-3-4-7-12-14-11/h13H,2-8H2,1H3.
What are the key properties of (2-oxopentylamino) 5-azidopentanoate?
(2-oxopentylamino) 5-azidopentanoate has a molecular weight of 242.28 g/mol, XLogP of 1.88, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopentylamino) 5-azidopentanoate is sourced from PubChem (CID 118680626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).