C28H31N3O3S — CID 118681593
methyl (1R,5R)-3-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 118681593) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is methyl (1R,5R)-3-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1R,5R)-3-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 118681593 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | methyl (1R,5R)-3-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H]1CN(c1nc(-c3cccc(C)c3OCc3cc(C)c4c(c3)CCNC4)cs1)C2 |
| InChI | InChI=1S/C28H31N3O3S/c1-17-5-4-6-22(25(17)34-14-19-9-18(2)23-12-29-8-7-20(23)10-19)24-15-35-27(30-24)31-13-21-11-28(21,16-31)26(32)33-3/h4-6,9-10,15,21,29H,7-8,11-14,16H2,1-3H3/t21-,28-/m0/s1 |
| InChIKey | GOVMXKHSHDDDAM-KMRXNPHXSA-N |
| XLogP | 4.65 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |