C19H19F3N2O — CID 118684244
[(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3H-pyrrol-5-yl)methanone (PubChem CID 118684244) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is [(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3H-pyrrol-5-yl)methanone.
| Compound Name | [(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3H-pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 118684244 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(3aR,6aS)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3H-pyrrol-5-yl)methanone |
| SMILES | O=C(C1=CCC=N1)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C19H19F3N2O/c20-19(21,22)16-5-2-1-4-15(16)12-8-13-10-24(11-14(13)9-12)18(25)17-6-3-7-23-17/h1-2,4-7,12-14H,3,8-11H2/t12?,13-,14+ |
| InChIKey | LKKCTLIIDDHPGZ-AGUYFDCRSA-N |
| XLogP | 4.02 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |