C21H24F3N3O — CID 153400718
[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone;ethane (PubChem CID 153400718) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is [(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone;ethane.
| Compound Name | [(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone;ethane |
|---|---|
| PubChem CID | 153400718 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone;ethane |
| SMILES | CC.O=C(c1cnccn1)N1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C19H18F3N3O.C2H6/c20-19(21,22)16-4-2-1-3-15(16)12-7-13-10-25(11-14(13)8-12)18(26)17-9-23-5-6-24-17;1-2/h1-6,9,12-14H,7-8,10-11H2;1-2H3/t12?,13-,14+; |
| InChIKey | PNHFOCOKXLRANQ-PCMHIUKPSA-N |
| XLogP | 4.79 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |