C19H32N4O7 — CID 118685314
[2-[3-(aziridin-1-yl)propanoyloxyamino]-2-[3-(aziridin-1-yl)propanoyloxymethyl]-3-hydroxypropyl] 3-(aziridin-1-yl)propanoate (PubChem CID 118685314) has the molecular formula C19H32N4O7 and a molecular weight of 428.49 g/mol. Its IUPAC name is [2-[3-(aziridin-1-yl)propanoyloxyamino]-2-[3-(aziridin-1-yl)propanoyloxymethyl]-3-hydroxypropyl] 3-(aziridin-1-yl)propanoate.
| Compound Name | [2-[3-(aziridin-1-yl)propanoyloxyamino]-2-[3-(aziridin-1-yl)propanoyloxymethyl]-3-hydroxypropyl] 3-(aziridin-1-yl)propanoate |
|---|---|
| PubChem CID | 118685314 |
| Molecular Formula | C19H32N4O7 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [2-[3-(aziridin-1-yl)propanoyloxyamino]-2-[3-(aziridin-1-yl)propanoyloxymethyl]-3-hydroxypropyl] 3-(aziridin-1-yl)propanoate |
| SMILES | O=C(CCN1CC1)OCC(CO)(COC(=O)CCN1CC1)NOC(=O)CCN1CC1 |
| InChI | InChI=1S/C19H32N4O7/c24-13-19(14-28-16(25)1-4-21-7-8-21,15-29-17(26)2-5-22-9-10-22)20-30-18(27)3-6-23-11-12-23/h20,24H,1-15H2 |
| InChIKey | UYBLXBHOVQOXBY-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|