C21H28O3 — CID 11868670
(2S,3S,5R,8S,9R,10S,13S,14S)-3-ethynyl-2-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione (PubChem CID 11868670) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2S,3S,5R,8S,9R,10S,13S,14S)-3-ethynyl-2-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (2S,3S,5R,8S,9R,10S,13S,14S)-3-ethynyl-2-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 11868670 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (2S,3S,5R,8S,9R,10S,13S,14S)-3-ethynyl-2-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
| SMILES | C#C[C@@H]1C[C@@H]2CC(=O)[C@H]3[C@@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)C[C@@H]1O |
| InChI | InChI=1S/C21H28O3/c1-4-12-9-13-10-16(22)19-14-5-6-18(24)20(14,2)8-7-15(19)21(13,3)11-17(12)23/h1,12-15,17,19,23H,5-11H2,2-3H3/t12-,13-,14+,15-,17+,19-,20+,21+/m1/s1 |
| InChIKey | RMHPKQZBZCPFIM-DJDURJTPSA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|