C65H41N5 — CID 118688194
1-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,7-diphenyl-9,9'-spirobi[fluorene]-2'-yl]-2-phenylbenzimidazole (PubChem CID 118688194) has the molecular formula C65H41N5 and a molecular weight of 892.08 g/mol. Its IUPAC name is 1-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,7-diphenyl-9,9'-spirobi[fluorene]-2'-yl]-2-phenylbenzimidazole.
| Compound Name | 1-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,7-diphenyl-9,9'-spirobi[fluorene]-2'-yl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 118688194 |
| Molecular Formula | C65H41N5 |
| Molecular Weight | 892.08 g/mol |
| Exact Mass | 891.34 |
| IUPAC Name | 1-[7'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,7-diphenyl-9,9'-spirobi[fluorene]-2'-yl]-2-phenylbenzimidazole |
| SMILES | c1ccc(-c2ccc3c(c2)C2(c4cc(-c5ccccc5)ccc4-3)c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-c3ccc(-n4c(-c5ccccc5)nc5ccccc54)cc32)cc1 |
| InChI | InChI=1S/C65H41N5/c1-6-18-42(19-7-1)47-30-34-51-52-35-31-48(43-20-8-2-9-21-43)39-56(52)65(55(51)38-47)57-40-49(63-68-61(44-22-10-3-11-23-44)67-62(69-63)45-24-12-4-13-25-45)32-36-53(57)54-37-33-50(41-58(54)65)70-60-29-17-16-28-59(60)66-64(70)46-26-14-5-15-27-46/h1-41H |
| InChIKey | UVJNAXFPJBCRHP-UHFFFAOYSA-N |
| XLogP | 15.56 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.08 |
| LogP ≤ 5 | 15.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |