C53H33N5O — CID 118688226
1-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-2-phenylbenzimidazole (PubChem CID 118688226) has the molecular formula C53H33N5O and a molecular weight of 755.88 g/mol. Its IUPAC name is 1-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-2-phenylbenzimidazole.
| Compound Name | 1-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 118688226 |
| Molecular Formula | C53H33N5O |
| Molecular Weight | 755.88 g/mol |
| Exact Mass | 755.27 |
| IUPAC Name | 1-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-2-phenylbenzimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5Oc5ccccc53)c3cc(-n5c(-c6ccccc6)nc6ccccc65)ccc3-4)n2)cc1 |
| InChI | InChI=1S/C53H33N5O/c1-4-16-34(17-5-1)49-55-50(35-18-6-2-7-19-35)57-51(56-49)37-28-30-39-40-31-29-38(58-46-25-13-12-24-45(46)54-52(58)36-20-8-3-9-21-36)33-44(40)53(43(39)32-37)41-22-10-14-26-47(41)59-48-27-15-11-23-42(48)53/h1-33H |
| InChIKey | XHJHUNCCSTZNPF-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.88 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |