C31H37N5O5 — CID 118689490
(2,6-dimethylphenyl) (10E)-16-[2-(4-hydroxypiperidin-1-yl)ethoxy]-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),10,15,17-heptaene-8-carboxylate (PubChem CID 118689490) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is (2,6-dimethylphenyl) (10E)-16-[2-(4-hydroxypiperidin-1-yl)ethoxy]-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),10,15,17-heptaene-8-carboxylate.
| Compound Name | (2,6-dimethylphenyl) (10E)-16-[2-(4-hydroxypiperidin-1-yl)ethoxy]-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),10,15,17-heptaene-8-carboxylate |
|---|---|
| PubChem CID | 118689490 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | (2,6-dimethylphenyl) (10E)-16-[2-(4-hydroxypiperidin-1-yl)ethoxy]-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),10,15,17-heptaene-8-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)N1C/C=C/COCc2cc(ccc2OCCN2CCC(O)CC2)Nc2nccc1n2 |
| InChI | InChI=1S/C31H37N5O5/c1-22-6-5-7-23(2)29(22)41-31(38)36-14-3-4-18-39-21-24-20-25(33-30-32-13-10-28(36)34-30)8-9-27(24)40-19-17-35-15-11-26(37)12-16-35/h3-10,13,20,26,37H,11-12,14-19,21H2,1-2H3,(H,32,33,34)/b4-3+ |
| InChIKey | NGBXCJNBLVXEEJ-ONEGZZNKSA-N |
| XLogP | 4.76 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|