C30H37N5O5 — CID 118689477
(2,6-dimethylphenyl) 16-(2-morpholin-4-ylethoxy)-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene-8-carboxylate (PubChem CID 118689477) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 16-(2-morpholin-4-ylethoxy)-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene-8-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 16-(2-morpholin-4-ylethoxy)-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 118689477 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | (2,6-dimethylphenyl) 16-(2-morpholin-4-ylethoxy)-13-oxa-2,4,8,20-tetrazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaene-8-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)N1CCCCOCc2cc(ccc2OCCN2CCOCC2)Nc2nccc1n2 |
| InChI | InChI=1S/C30H37N5O5/c1-22-6-5-7-23(2)28(22)40-30(36)35-12-3-4-16-38-21-24-20-25(32-29-31-11-10-27(35)33-29)8-9-26(24)39-19-15-34-13-17-37-18-14-34/h5-11,20H,3-4,12-19,21H2,1-2H3,(H,31,32,33) |
| InChIKey | RPPQQSXXFFXZJA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |