C32H41N5O3 — CID 70887150
(16E)-14-butan-2-yl-11-(2-morpholin-4-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 70887150) has the molecular formula C32H41N5O3 and a molecular weight of 543.71 g/mol. Its IUPAC name is (16E)-14-butan-2-yl-11-(2-morpholin-4-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-14-butan-2-yl-11-(2-morpholin-4-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 70887150 |
| Molecular Formula | C32H41N5O3 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | (16E)-14-butan-2-yl-11-(2-morpholin-4-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | CCC(C)N1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2ccc(OCCN3CCOCC3)c(c2)C1 |
| InChI | InChI=1S/C32H41N5O3/c1-3-25(2)37-14-5-4-6-18-39-29-9-7-8-26(23-29)30-12-13-33-32(35-30)34-28-10-11-31(27(22-28)24-37)40-21-17-36-15-19-38-20-16-36/h4-5,7-13,22-23,25H,3,6,14-21,24H2,1-2H3,(H,33,34,35)/b5-4- |
| InChIKey | JZMAJLMGVKBQFN-PLNGDYQASA-N |
| XLogP | 5.54 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|