C29H35N5O2 — CID 171081343
(16Z)-14-(2-piperidin-4-yloxyethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene (PubChem CID 171081343) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is (16Z)-14-(2-piperidin-4-yloxyethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene.
| Compound Name | (16Z)-14-(2-piperidin-4-yloxyethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 171081343 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (16Z)-14-(2-piperidin-4-yloxyethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
| SMILES | C1=C/CN(CCOC2CCNCC2)Cc2cccc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/1 |
| InChI | InChI=1S/C29H35N5O2/c1-2-16-34(17-19-36-26-10-13-30-14-11-26)22-23-6-4-8-25(20-23)32-29-31-15-12-28(33-29)24-7-5-9-27(21-24)35-18-3-1/h1-2,4-9,12,15,20-21,26,30H,3,10-11,13-14,16-19,22H2,(H,31,32,33)/b2-1+ |
| InChIKey | IHQPXRIMSRZXKI-OWOJBTEDSA-N |
| XLogP | 4.80 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|