C33H40N6O2 — CID 122550838
1-[4-[2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 122550838) has the molecular formula C33H40N6O2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 1-[4-[2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122550838 |
| Molecular Formula | C33H40N6O2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[4-[2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(CCNc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C\CN(C)C3)CC1 |
| InChI | InChI=1S/C33H40N6O2/c1-3-32(40)39-17-12-25(13-18-39)10-14-34-28-20-26-21-29(23-28)36-33-35-15-11-31(37-33)27-8-7-9-30(22-27)41-19-6-4-5-16-38(2)24-26/h3-5,7-9,11,15,20-23,25,34H,1,6,10,12-14,16-19,24H2,2H3,(H,35,36,37)/b5-4- |
| InChIKey | KYJHQKGKNRMDIV-PLNGDYQASA-N |
| XLogP | 5.88 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|