C34H38N6O3 — CID 134166188
2-(1-but-2-ynoylpiperidin-4-yl)-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide (PubChem CID 134166188) has the molecular formula C34H38N6O3 and a molecular weight of 578.72 g/mol. Its IUPAC name is 2-(1-but-2-ynoylpiperidin-4-yl)-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide.
| Compound Name | 2-(1-but-2-ynoylpiperidin-4-yl)-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide |
|---|---|
| PubChem CID | 134166188 |
| Molecular Formula | C34H38N6O3 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 2-(1-but-2-ynoylpiperidin-4-yl)-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide |
| SMILES | CC#CC(=O)N1CCC(CC(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C\CN(C)C3)CC1 |
| InChI | InChI=1S/C34H38N6O3/c1-3-8-33(42)40-16-12-25(13-17-40)21-32(41)36-28-19-26-20-29(23-28)37-34-35-14-11-31(38-34)27-9-7-10-30(22-27)43-18-6-4-5-15-39(2)24-26/h4-5,7,9-11,14,19-20,22-23,25H,6,12-13,15-18,21,24H2,1-2H3,(H,36,41)(H,35,37,38)/b5-4- |
| InChIKey | DYNPCJKMTIGQAF-PLNGDYQASA-N |
| XLogP | 5.25 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|