C31H32N6O3 — CID 134166195
1-but-2-ynoyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]azetidine-3-carboxamide (PubChem CID 134166195) has the molecular formula C31H32N6O3 and a molecular weight of 536.64 g/mol. Its IUPAC name is 1-but-2-ynoyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]azetidine-3-carboxamide.
| Compound Name | 1-but-2-ynoyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 134166195 |
| Molecular Formula | C31H32N6O3 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 1-but-2-ynoyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]azetidine-3-carboxamide |
| SMILES | CC#CC(=O)N1CC(C(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C\CN(C)C3)C1 |
| InChI | InChI=1S/C31H32N6O3/c1-3-8-29(38)37-20-24(21-37)30(39)33-25-15-22-16-26(18-25)34-31-32-12-11-28(35-31)23-9-7-10-27(17-23)40-14-6-4-5-13-36(2)19-22/h4-5,7,9-12,15-18,24H,6,13-14,19-21H2,1-2H3,(H,33,39)(H,32,34,35)/b5-4- |
| InChIKey | ZMMJOQZMXHWYOL-PLNGDYQASA-N |
| XLogP | 4.08 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|