C29H31N5O2 — CID 176723325
N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]hex-2-ynamide (PubChem CID 176723325) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]hex-2-ynamide.
| Compound Name | N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]hex-2-ynamide |
|---|---|
| PubChem CID | 176723325 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]hex-2-ynamide |
| SMILES | CCCC#CC(=O)Nc1cc2cc(c1)Nc1nccc(n1)-c1cccc(c1)COC/C=C\CN(C)C2 |
| InChI | InChI=1S/C29H31N5O2/c1-3-4-5-11-28(35)31-25-17-23-18-26(19-25)32-29-30-13-12-27(33-29)24-10-8-9-22(16-24)21-36-15-7-6-14-34(2)20-23/h6-10,12-13,16-19H,3-4,14-15,20-21H2,1-2H3,(H,31,35)(H,30,32,33)/b7-6- |
| InChIKey | YNYHYHWYYHXRJI-SREVYHEPSA-N |
| XLogP | 5.15 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|