C30H32N6O4 — CID 176723304
(E)-N-[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]-4-oxo-4-piperazin-1-ylbut-2-enamide (PubChem CID 176723304) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is (E)-N-[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]-4-oxo-4-piperazin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]-4-oxo-4-piperazin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 176723304 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (E)-N-[(16E)-14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]-4-oxo-4-piperazin-1-ylbut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1CCNCC1)Nc1cc2cc(c1)Nc1nccc(n1)-c1cccc(c1)COC/C=C/COC2 |
| InChI | InChI=1S/C30H32N6O4/c37-28(6-7-29(38)36-12-10-31-11-13-36)33-25-17-23-18-26(19-25)34-30-32-9-8-27(35-30)24-5-3-4-22(16-24)20-39-14-1-2-15-40-21-23/h1-9,16-19,31H,10-15,20-21H2,(H,33,37)(H,32,34,35)/b2-1+,7-6+ |
| InChIKey | HWHCECPZYAMZKU-NRLOHAHISA-N |
| XLogP | 3.42 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|