C29H34N6O2 — CID 176723311
(E)-4-(dimethylamino)-N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]but-2-enamide (PubChem CID 176723311) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]but-2-enamide |
|---|---|
| PubChem CID | 176723311 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[(16E)-14-methyl-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-10-yl]but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2cc(c1)Nc1nccc(n1)-c1cccc(c1)COC/C=C\CN(C)C2 |
| InChI | InChI=1S/C29H34N6O2/c1-34(2)13-7-10-28(36)31-25-17-23-18-26(19-25)32-29-30-12-11-27(33-29)24-9-6-8-22(16-24)21-37-15-5-4-14-35(3)20-23/h4-12,16-19H,13-15,20-21H2,1-3H3,(H,31,36)(H,30,32,33)/b5-4-,10-7+ |
| InChIKey | XWBJOMAEMCVEOU-DOIONKORSA-N |
| XLogP | 4.46 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|