C30H36N4O2 — CID 147443902
8-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]octan-2-one (PubChem CID 147443902) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 8-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]octan-2-one.
| Compound Name | 8-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]octan-2-one |
|---|---|
| PubChem CID | 147443902 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 8-[(16E)-19-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaen-14-yl]octan-2-one |
| SMILES | CC(=O)CCCCCCN1C/C=C\COCc2cccc(c2)-c2ccnc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C30H36N4O2/c1-24(35)10-4-2-3-5-17-34-18-6-7-19-36-23-26-12-8-13-27(20-26)29-15-16-31-30(33-29)32-28-14-9-11-25(21-28)22-34/h6-9,11-16,20-21H,2-5,10,17-19,22-23H2,1H3,(H,31,32,33)/b7-6- |
| InChIKey | DWTBOEYVVFULQS-SREVYHEPSA-N |
| XLogP | 6.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|