C21H19N3O3 — CID 136596237
(16E)-14,19-dioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),16,20,22-decaen-21-ol (PubChem CID 136596237) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (16E)-14,19-dioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),16,20,22-decaen-21-ol.
| Compound Name | (16E)-14,19-dioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),16,20,22-decaen-21-ol |
|---|---|
| PubChem CID | 136596237 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (16E)-14,19-dioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),16,20,22-decaen-21-ol |
| SMILES | Oc1ccc2cc1OC/C=C/COCc1cccc(c1)Nc1nccc-2n1 |
| InChI | InChI=1S/C21H19N3O3/c25-19-7-6-16-13-20(19)27-11-2-1-10-26-14-15-4-3-5-17(12-15)23-21-22-9-8-18(16)24-21/h1-9,12-13,25H,10-11,14H2,(H,22,23,24)/b2-1+ |
| InChIKey | KRYSGVRXXBBMQA-OWOJBTEDSA-N |
| XLogP | 4.06 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|