C34H34N6O3 — CID 134166141
3-methyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-4-(prop-2-enoylamino)benzamide (PubChem CID 134166141) has the molecular formula C34H34N6O3 and a molecular weight of 574.69 g/mol. Its IUPAC name is 3-methyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-4-(prop-2-enoylamino)benzamide.
| Compound Name | 3-methyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-4-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 134166141 |
| Molecular Formula | C34H34N6O3 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 3-methyl-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-4-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C\CN(C)C3)cc1C |
| InChI | InChI=1S/C34H34N6O3/c1-4-32(41)38-30-12-11-26(17-23(30)2)33(42)36-27-18-24-19-28(21-27)37-34-35-14-13-31(39-34)25-9-8-10-29(20-25)43-16-7-5-6-15-40(3)22-24/h4-6,8-14,17-21H,1,7,15-16,22H2,2-3H3,(H,36,42)(H,38,41)(H,35,37,39)/b6-5- |
| InChIKey | ZLWRMGPBVQDZNM-WAYWQWQTSA-N |
| XLogP | 6.34 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|