C30H29N5O5S — CID 138650360
N-[4-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]sulfamoyl]phenyl]acetamide (PubChem CID 138650360) has the molecular formula C30H29N5O5S and a molecular weight of 571.66 g/mol. Its IUPAC name is N-[4-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 138650360 |
| Molecular Formula | C30H29N5O5S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | N-[4-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C/COC3)cc1 |
| InChI | InChI=1S/C30H29N5O5S/c1-21(36)32-24-8-10-28(11-9-24)41(37,38)35-26-17-22-16-25(19-26)33-30-31-13-12-29(34-30)23-6-5-7-27(18-23)40-15-4-2-3-14-39-20-22/h2-3,5-13,16-19,35H,4,14-15,20H2,1H3,(H,32,36)(H,31,33,34)/b3-2+ |
| InChIKey | HILIVWJDHGDJQI-NSCUHMNNSA-N |
| XLogP | 5.50 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|