C32H30N4O5S — CID 157467099
N-[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-3-(2-oxobut-3-enyl)benzenesulfonamide (PubChem CID 157467099) has the molecular formula C32H30N4O5S and a molecular weight of 582.68 g/mol. Its IUPAC name is N-[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-3-(2-oxobut-3-enyl)benzenesulfonamide.
| Compound Name | N-[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-3-(2-oxobut-3-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 157467099 |
| Molecular Formula | C32H30N4O5S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | N-[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]-3-(2-oxobut-3-enyl)benzenesulfonamide |
| SMILES | C=CC(=O)Cc1cccc(S(=O)(=O)Nc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C/COC3)c1 |
| InChI | InChI=1S/C32H30N4O5S/c1-2-28(37)18-23-8-6-11-30(19-23)42(38,39)36-27-17-24-16-26(21-27)34-32-33-13-12-31(35-32)25-9-7-10-29(20-25)41-15-5-3-4-14-40-22-24/h2-4,6-13,16-17,19-21,36H,1,5,14-15,18,22H2,(H,33,34,35)/b4-3+ |
| InChIKey | UTTYJCDYZKDSBC-ONEGZZNKSA-N |
| XLogP | 5.84 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|