C33H38N6O3 — CID 122550875
1-[4-[3-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]propyl]piperazin-1-yl]but-2-yn-1-one (PubChem CID 122550875) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is 1-[4-[3-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]propyl]piperazin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[4-[3-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]propyl]piperazin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 122550875 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 1-[4-[3-[[(16E)-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]amino]propyl]piperazin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCN(CCCNc2cc3cc(c2)Nc2nccc(n2)-c2cccc(c2)OCC/C=C/COC3)CC1 |
| InChI | InChI=1S/C33H38N6O3/c1-2-8-32(40)39-17-15-38(16-18-39)14-7-12-34-28-21-26-22-29(24-28)36-33-35-13-11-31(37-33)27-9-6-10-30(23-27)42-20-5-3-4-19-41-25-26/h3-4,6,9-11,13,21-24,34H,5,7,12,14-20,25H2,1H3,(H,35,36,37)/b4-3+ |
| InChIKey | JIFLDNKOGYRONX-ONEGZZNKSA-N |
| XLogP | 4.71 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|