C27H31N5O — CID 16739811
(16E)-14-methyl-4-pyrrolidin-1-yl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2,4,6(27),8,10,12(26),16,21,23-decaene (PubChem CID 16739811) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is (16E)-14-methyl-4-pyrrolidin-1-yl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2,4,6(27),8,10,12(26),16,21,23-decaene.
| Compound Name | (16E)-14-methyl-4-pyrrolidin-1-yl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2,4,6(27),8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 16739811 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (16E)-14-methyl-4-pyrrolidin-1-yl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2,4,6(27),8,10,12(26),16,21,23-decaene |
| SMILES | CN1C/C=C\CCOc2cccc(c2)-c2cc(N3CCCC3)nc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C27H31N5O/c1-31-13-3-2-6-16-33-24-12-8-10-22(18-24)25-19-26(32-14-4-5-15-32)30-27(29-25)28-23-11-7-9-21(17-23)20-31/h2-3,7-12,17-19H,4-6,13-16,20H2,1H3,(H,28,29,30)/b3-2- |
| InChIKey | LKYBNWASGDSVOP-IHWYPQMZSA-N |
| XLogP | 5.26 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|