C23H28N4O — CID 167993960
(16Z)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),5,8,10,12(26),16,21,23-octaene (PubChem CID 167993960) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is (16Z)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),5,8,10,12(26),16,21,23-octaene.
| Compound Name | (16Z)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),5,8,10,12(26),16,21,23-octaene |
|---|---|
| PubChem CID | 167993960 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (16Z)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),5,8,10,12(26),16,21,23-octaene |
| SMILES | CN1C/C=C/CCOc2cccc(c2)C2CCN=C(Nc3cccc(c3)C1)N2 |
| InChI | InChI=1S/C23H28N4O/c1-27-13-3-2-4-14-28-21-10-6-8-19(16-21)22-11-12-24-23(26-22)25-20-9-5-7-18(15-20)17-27/h2-3,5-10,15-16,22H,4,11-14,17H2,1H3,(H2,24,25,26)/b3-2+ |
| InChIKey | ZDDZSWHKLLFHLI-NSCUHMNNSA-N |
| XLogP | 3.96 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|