C24H25FN4O — CID 16739868
(16E)-23-fluoro-3,14-dimethyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene (PubChem CID 16739868) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is (16E)-23-fluoro-3,14-dimethyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene.
| Compound Name | (16E)-23-fluoro-3,14-dimethyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 16739868 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (16E)-23-fluoro-3,14-dimethyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
| SMILES | Cc1cnc2nc1-c1cc(F)cc(c1)OCC/C=C\CN(C)Cc1cccc(c1)N2 |
| InChI | InChI=1S/C24H25FN4O/c1-17-15-26-24-27-21-8-6-7-18(11-21)16-29(2)9-4-3-5-10-30-22-13-19(23(17)28-24)12-20(25)14-22/h3-4,6-8,11-15H,5,9-10,16H2,1-2H3,(H,26,27,28)/b4-3- |
| InChIKey | WIOMOUGQOGKTQE-ARJAWSKDSA-N |
| XLogP | 5.11 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|