C26H29FN4O3 — CID 16739932
(16E)-23-fluoro-11-(2-methoxyethoxy)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 16739932) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is (16E)-23-fluoro-11-(2-methoxyethoxy)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-23-fluoro-11-(2-methoxyethoxy)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 16739932 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (16E)-23-fluoro-11-(2-methoxyethoxy)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | COCCOc1ccc2cc1CN(C)C/C=C\CCOc1cc(F)cc(c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C26H29FN4O3/c1-31-10-4-3-5-11-33-23-16-19(14-21(27)17-23)24-8-9-28-26(30-24)29-22-6-7-25(20(15-22)18-31)34-13-12-32-2/h3-4,6-9,14-17H,5,10-13,18H2,1-2H3,(H,28,29,30)/b4-3- |
| InChIKey | DHIFXTHTDCEZCS-ARJAWSKDSA-N |
| XLogP | 4.82 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|