C27H28FN7O2 — CID 16739964
(16E)-23-fluoro-14-methyl-11-[2-(1,2,4-triazol-1-yl)ethoxy]-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 16739964) has the molecular formula C27H28FN7O2 and a molecular weight of 501.57 g/mol. Its IUPAC name is (16E)-23-fluoro-14-methyl-11-[2-(1,2,4-triazol-1-yl)ethoxy]-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-23-fluoro-14-methyl-11-[2-(1,2,4-triazol-1-yl)ethoxy]-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 16739964 |
| Molecular Formula | C27H28FN7O2 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (16E)-23-fluoro-14-methyl-11-[2-(1,2,4-triazol-1-yl)ethoxy]-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | CN1C/C=C\CCOc2cc(F)cc(c2)-c2ccnc(n2)Nc2ccc(OCCn3cncn3)c(c2)C1 |
| InChI | InChI=1S/C27H28FN7O2/c1-34-9-3-2-4-11-36-24-15-20(13-22(28)16-24)25-7-8-30-27(33-25)32-23-5-6-26(21(14-23)17-34)37-12-10-35-19-29-18-31-35/h2-3,5-8,13-16,18-19H,4,9-12,17H2,1H3,(H,30,32,33)/b3-2- |
| InChIKey | DLURZHXUWYBKRD-IHWYPQMZSA-N |
| XLogP | 4.47 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|