C23H27N5O — CID 89066188
(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),5,8(26),9,11,16,21,23-nonaen-10-amine (PubChem CID 89066188) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is (16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),5,8(26),9,11,16,21,23-nonaen-10-amine.
| Compound Name | (16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),5,8(26),9,11,16,21,23-nonaen-10-amine |
|---|---|
| PubChem CID | 89066188 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),5,8(26),9,11,16,21,23-nonaen-10-amine |
| SMILES | CN1C/C=C\CCOc2cccc(c2)C2=NC(=NCC2)Nc2cc(N)cc(c2)C1 |
| InChI | InChI=1S/C23H27N5O/c1-28-10-3-2-4-11-29-21-7-5-6-18(14-21)22-8-9-25-23(27-22)26-20-13-17(16-28)12-19(24)15-20/h2-3,5-7,12-15H,4,8-11,16,24H2,1H3,(H,25,26)/b3-2- |
| InChIKey | CVDSWJMIBVANOU-IHWYPQMZSA-N |
| XLogP | 3.70 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|