C16H17ClN4O2 — CID 118692496
N-[5-chloro-3-(cyclobutadienyl)imidazo[4,5-b]pyridin-2-yl]-3-methoxy-3-methylbutanamide (PubChem CID 118692496) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-[5-chloro-3-(cyclobutadienyl)imidazo[4,5-b]pyridin-2-yl]-3-methoxy-3-methylbutanamide.
| Compound Name | N-[5-chloro-3-(cyclobutadienyl)imidazo[4,5-b]pyridin-2-yl]-3-methoxy-3-methylbutanamide |
|---|---|
| PubChem CID | 118692496 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[5-chloro-3-(cyclobutadienyl)imidazo[4,5-b]pyridin-2-yl]-3-methoxy-3-methylbutanamide |
| SMILES | COC(C)(C)CC(=O)Nc1nc2ccc(Cl)nc2n1C1=CC=C1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-16(2,23-3)9-13(22)20-15-18-11-7-8-12(17)19-14(11)21(15)10-5-4-6-10/h4-8H,9H2,1-3H3,(H,18,20,22) |
| InChIKey | TVUHSCIGCQXUIU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|