C22H18ClFN4O2 — CID 137393658
N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide (PubChem CID 137393658) has the molecular formula C22H18ClFN4O2 and a molecular weight of 424.86 g/mol. Its IUPAC name is N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide.
| Compound Name | N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 137393658 |
| Molecular Formula | C22H18ClFN4O2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
| SMILES | CC(O)(CC(=O)Nc1nc2ccc(Cl)nc2n1-c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18ClFN4O2/c1-22(30,14-5-3-2-4-6-14)13-19(29)27-21-25-17-11-12-18(23)26-20(17)28(21)16-9-7-15(24)8-10-16/h2-12,30H,13H2,1H3,(H,25,27,29) |
| InChIKey | OONPADOWOUZJBD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|