C22H25ClN4O2 — CID 130359679
(3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-(4-methylphenyl)butanamide (PubChem CID 130359679) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-(4-methylphenyl)butanamide.
| Compound Name | (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 130359679 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc([C@@](C)(O)CC(=O)Nc2nc3ccc(Cl)nc3n2C2(C)CCC2)cc1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-14-5-7-15(8-6-14)22(3,29)13-18(28)26-20-24-16-9-10-17(23)25-19(16)27(20)21(2)11-4-12-21/h5-10,29H,4,11-13H2,1-3H3,(H,24,26,28)/t22-/m0/s1 |
| InChIKey | RTEUXLZVZGYOMU-QFIPXVFZSA-N |
| XLogP | 4.53 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|