C21H23ClN4O2 — CID 130359666
(3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide (PubChem CID 130359666) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide.
| Compound Name | (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 130359666 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3S)-N-[5-chloro-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
| SMILES | CC1(n2c(NC(=O)C[C@](C)(O)c3ccccc3)nc3ccc(Cl)nc32)CCC1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-20(11-6-12-20)26-18-15(9-10-16(22)24-18)23-19(26)25-17(27)13-21(2,28)14-7-4-3-5-8-14/h3-5,7-10,28H,6,11-13H2,1-2H3,(H,23,25,27)/t21-/m0/s1 |
| InChIKey | XCDBOOYFQJVYCO-NRFANRHFSA-N |
| XLogP | 4.22 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|