C22H25ClN4O3 — CID 167288244
N-[5-chloro-7-methoxy-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide (PubChem CID 167288244) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is N-[5-chloro-7-methoxy-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide.
| Compound Name | N-[5-chloro-7-methoxy-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 167288244 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[5-chloro-7-methoxy-3-(1-methylcyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
| SMILES | COc1cc(Cl)nc2c1nc(NC(=O)CC(C)(O)c1ccccc1)n2C1(C)CCC1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-21(10-7-11-21)27-19-18(15(30-3)12-16(23)24-19)26-20(27)25-17(28)13-22(2,29)14-8-5-4-6-9-14/h4-6,8-9,12,29H,7,10-11,13H2,1-3H3,(H,25,26,28) |
| InChIKey | LCFJEIKFHZYWGV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|