C25H30ClN3O3 — CID 139518194
8-(5-chloro-3-cyclobutyl-7-methoxyimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-phenyloctan-4-one (PubChem CID 139518194) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is 8-(5-chloro-3-cyclobutyl-7-methoxyimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-phenyloctan-4-one.
| Compound Name | 8-(5-chloro-3-cyclobutyl-7-methoxyimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-phenyloctan-4-one |
|---|---|
| PubChem CID | 139518194 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 8-(5-chloro-3-cyclobutyl-7-methoxyimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-phenyloctan-4-one |
| SMILES | COc1cc(Cl)nc2c1nc(CCCCC(=O)CC(C)(O)c1ccccc1)n2C1CCC1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-25(31,17-9-4-3-5-10-17)16-19(30)13-6-7-14-22-28-23-20(32-2)15-21(26)27-24(23)29(22)18-11-8-12-18/h3-5,9-10,15,18,31H,6-8,11-14,16H2,1-2H3 |
| InChIKey | NZBHWYUCEJBMQU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|