C20H28ClN3O2 — CID 139518269
8-(5-chloro-3-cyclobutyl-7-methylimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-methyloctan-4-one (PubChem CID 139518269) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 8-(5-chloro-3-cyclobutyl-7-methylimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-methyloctan-4-one.
| Compound Name | 8-(5-chloro-3-cyclobutyl-7-methylimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-methyloctan-4-one |
|---|---|
| PubChem CID | 139518269 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 8-(5-chloro-3-cyclobutyl-7-methylimidazo[4,5-b]pyridin-2-yl)-2-hydroxy-2-methyloctan-4-one |
| SMILES | Cc1cc(Cl)nc2c1nc(CCCCC(=O)CC(C)(C)O)n2C1CCC1 |
| InChI | InChI=1S/C20H28ClN3O2/c1-13-11-16(21)22-19-18(13)23-17(24(19)14-7-6-8-14)10-5-4-9-15(25)12-20(2,3)26/h11,14,26H,4-10,12H2,1-3H3 |
| InChIKey | IBADAYKAHLHNJJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|