C20H27F2N3O3 — CID 139518479
8-(3-cyclobutyl-5-methoxyimidazo[4,5-b]pyridin-2-yl)-1-fluoro-2-(fluoromethyl)-2-hydroxyoctan-4-one (PubChem CID 139518479) has the molecular formula C20H27F2N3O3 and a molecular weight of 395.45 g/mol. Its IUPAC name is 8-(3-cyclobutyl-5-methoxyimidazo[4,5-b]pyridin-2-yl)-1-fluoro-2-(fluoromethyl)-2-hydroxyoctan-4-one.
| Compound Name | 8-(3-cyclobutyl-5-methoxyimidazo[4,5-b]pyridin-2-yl)-1-fluoro-2-(fluoromethyl)-2-hydroxyoctan-4-one |
|---|---|
| PubChem CID | 139518479 |
| Molecular Formula | C20H27F2N3O3 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 8-(3-cyclobutyl-5-methoxyimidazo[4,5-b]pyridin-2-yl)-1-fluoro-2-(fluoromethyl)-2-hydroxyoctan-4-one |
| SMILES | COc1ccc2nc(CCCCC(=O)CC(O)(CF)CF)n(C3CCC3)c2n1 |
| InChI | InChI=1S/C20H27F2N3O3/c1-28-18-10-9-16-19(24-18)25(14-5-4-6-14)17(23-16)8-3-2-7-15(26)11-20(27,12-21)13-22/h9-10,14,27H,2-8,11-13H2,1H3 |
| InChIKey | YABKDLPNTRBVEF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|