C20H25F3N2O3 — CID 139518094
1-[1-cyclobutyl-7-(trifluoromethoxy)benzimidazol-2-yl]-6-hydroxy-6-methylheptan-4-one (PubChem CID 139518094) has the molecular formula C20H25F3N2O3 and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-[1-cyclobutyl-7-(trifluoromethoxy)benzimidazol-2-yl]-6-hydroxy-6-methylheptan-4-one.
| Compound Name | 1-[1-cyclobutyl-7-(trifluoromethoxy)benzimidazol-2-yl]-6-hydroxy-6-methylheptan-4-one |
|---|---|
| PubChem CID | 139518094 |
| Molecular Formula | C20H25F3N2O3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[1-cyclobutyl-7-(trifluoromethoxy)benzimidazol-2-yl]-6-hydroxy-6-methylheptan-4-one |
| SMILES | CC(C)(O)CC(=O)CCCc1nc2cccc(OC(F)(F)F)c2n1C1CCC1 |
| InChI | InChI=1S/C20H25F3N2O3/c1-19(2,27)12-14(26)8-4-11-17-24-15-9-5-10-16(28-20(21,22)23)18(15)25(17)13-6-3-7-13/h5,9-10,13,27H,3-4,6-8,11-12H2,1-2H3 |
| InChIKey | GYLJVKIRHQENEP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |