C17H22FN3O3 — CID 129075871
N-(1-cyclobutyl-7-fluoro-6-methoxybenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide (PubChem CID 129075871) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is N-(1-cyclobutyl-7-fluoro-6-methoxybenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide.
| Compound Name | N-(1-cyclobutyl-7-fluoro-6-methoxybenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 129075871 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(1-cyclobutyl-7-fluoro-6-methoxybenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide |
| SMILES | COc1ccc2nc(NC(=O)CC(C)(C)O)n(C3CCC3)c2c1F |
| InChI | InChI=1S/C17H22FN3O3/c1-17(2,23)9-13(22)20-16-19-11-7-8-12(24-3)14(18)15(11)21(16)10-5-4-6-10/h7-8,10,23H,4-6,9H2,1-3H3,(H,19,20,22) |
| InChIKey | ADOFLRIYHXUJBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |