About N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide
N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide (PubChem CID 129064863) has the molecular formula C16H21F2N3O2
and a molecular weight of 325.36 g/mol. Its IUPAC name is N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide.
Molecular Properties
| Compound Name | N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide |
| PubChem CID | 129064863 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide |
| SMILES | CC(C)(O)CC(=O)Nc1nc2ccc(F)c(F)c2n1C(C)(C)C |
| InChI | InChI=1S/C16H21F2N3O2/c1-15(2,3)21-13-10(7-6-9(17)12(13)18)19-14(21)20-11(22)8-16(4,5)23/h6-7,23H,8H2,1-5H3,(H,19,20,22) |
| InChIKey | WOCBIFHAUSWYLK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide?
The IUPAC name of N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide (CID 129064863) is N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide.
What is the SMILES notation for N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide?
The canonical SMILES for N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide is CC(C)(O)CC(=O)Nc1nc2ccc(F)c(F)c2n1C(C)(C)C.
What is the InChIKey of N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide?
The InChIKey is WOCBIFHAUSWYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N3O2/c1-15(2,3)21-13-10(7-6-9(17)12(13)18)19-14(21)20-11(22)8-16(4,5)23/h6-7,23H,8H2,1-5H3,(H,19,20,22).
What are the key properties of N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide?
N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide has a molecular weight of 325.36 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-tert-butyl-6,7-difluorobenzimidazol-2-yl)-3-hydroxy-3-methylbutanamide is sourced from PubChem (CID 129064863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).