C18H23F3N4O2 — CID 158425795
(3R)-N-(1-tert-butyl-6-isocyanobenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide;methane (PubChem CID 158425795) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is (3R)-N-(1-tert-butyl-6-isocyanobenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide;methane.
| Compound Name | (3R)-N-(1-tert-butyl-6-isocyanobenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide;methane |
|---|---|
| PubChem CID | 158425795 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3R)-N-(1-tert-butyl-6-isocyanobenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide;methane |
| SMILES | C.[C-]#[N+]c1ccc2nc(NC(=O)C[C@@](C)(O)C(F)(F)F)n(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C17H19F3N4O2.CH4/c1-15(2,3)24-12-8-10(21-5)6-7-11(12)22-14(24)23-13(25)9-16(4,26)17(18,19)20;/h6-8,26H,9H2,1-4H3,(H,22,23,25);1H4/t16-;/m1./s1 |
| InChIKey | HBALYDQPSYPDLP-PKLMIRHRSA-N |
| XLogP | 4.62 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|