C18H21F3N4O2 — CID 140706475
(3S)-N-(1-tert-butyl-6-isocyano-5-methylbenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide (PubChem CID 140706475) has the molecular formula C18H21F3N4O2 and a molecular weight of 382.39 g/mol. Its IUPAC name is (3S)-N-(1-tert-butyl-6-isocyano-5-methylbenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide.
| Compound Name | (3S)-N-(1-tert-butyl-6-isocyano-5-methylbenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 140706475 |
| Molecular Formula | C18H21F3N4O2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (3S)-N-(1-tert-butyl-6-isocyano-5-methylbenzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxy-3-methylbutanamide |
| SMILES | [C-]#[N+]c1cc2c(cc1C)nc(NC(=O)C[C@](C)(O)C(F)(F)F)n2C(C)(C)C |
| InChI | InChI=1S/C18H21F3N4O2/c1-10-7-12-13(8-11(10)22-6)25(16(2,3)4)15(23-12)24-14(26)9-17(5,27)18(19,20)21/h7-8,27H,9H2,1-5H3,(H,23,24,26)/t17-/m0/s1 |
| InChIKey | VTGHTJOZSRBQNC-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|