C21H27N5O3 — CID 159153039
tert-butyl N-[4-[(1-cyclobutyl-6-isocyanobenzimidazol-2-yl)amino]-4-oxobutan-2-yl]carbamate (PubChem CID 159153039) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-cyclobutyl-6-isocyanobenzimidazol-2-yl)amino]-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-cyclobutyl-6-isocyanobenzimidazol-2-yl)amino]-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 159153039 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl N-[4-[(1-cyclobutyl-6-isocyanobenzimidazol-2-yl)amino]-4-oxobutan-2-yl]carbamate |
| SMILES | [C-]#[N+]c1ccc2nc(NC(=O)CC(C)NC(=O)OC(C)(C)C)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C21H27N5O3/c1-13(23-20(28)29-21(2,3)4)11-18(27)25-19-24-16-10-9-14(22-5)12-17(16)26(19)15-7-6-8-15/h9-10,12-13,15H,6-8,11H2,1-4H3,(H,23,28)(H,24,25,27) |
| InChIKey | UEMXWBBUASHJPR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|